C22H22ClF2N5OS — CID 130435030
(4S,6R)-4-[5-[(3-chloro-1,7-naphthyridin-8-yl)amino]-2,3-difluorophenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine (PubChem CID 130435030) has the molecular formula C22H22ClF2N5OS and a molecular weight of 477.97 g/mol. Its IUPAC name is (4S,6R)-4-[5-[(3-chloro-1,7-naphthyridin-8-yl)amino]-2,3-difluorophenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,6R)-4-[5-[(3-chloro-1,7-naphthyridin-8-yl)amino]-2,3-difluorophenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 130435030 |
| Molecular Formula | C22H22ClF2N5OS |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (4S,6R)-4-[5-[(3-chloro-1,7-naphthyridin-8-yl)amino]-2,3-difluorophenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine |
| SMILES | COC[C@@]1(C)C[C@@](C)(c2cc(Nc3nccc4cc(Cl)cnc34)cc(F)c2F)N=C(N)S1 |
| InChI | InChI=1S/C22H22ClF2N5OS/c1-21(11-31-3)10-22(2,30-20(26)32-21)15-7-14(8-16(24)17(15)25)29-19-18-12(4-5-27-19)6-13(23)9-28-18/h4-9H,10-11H2,1-3H3,(H2,26,30)(H,27,29)/t21-,22+/m1/s1 |
| InChIKey | LYMPOARZWWSCIF-YADHBBJMSA-N |
| XLogP | 5.38 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |