C25H21F2N7O3S — CID 126488448
(1S,5R)-5-[2,3-difluoro-5-[[2-(1,3-oxazol-2-ylmethoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hepta-3,6-dien-3-amine (PubChem CID 126488448) has the molecular formula C25H21F2N7O3S and a molecular weight of 537.55 g/mol. Its IUPAC name is (1S,5R)-5-[2,3-difluoro-5-[[2-(1,3-oxazol-2-ylmethoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hepta-3,6-dien-3-amine.
| Compound Name | (1S,5R)-5-[2,3-difluoro-5-[[2-(1,3-oxazol-2-ylmethoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hepta-3,6-dien-3-amine |
|---|---|
| PubChem CID | 126488448 |
| Molecular Formula | C25H21F2N7O3S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (1S,5R)-5-[2,3-difluoro-5-[[2-(1,3-oxazol-2-ylmethoxy)pyrido[3,4-b]pyrazin-5-yl]amino]phenyl]-1-(methoxymethyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hepta-3,6-dien-3-amine |
| SMILES | COC[C@]12C=C1[C@@](C)(c1cc(Nc3nccc4nc(OCc5ncco5)cnc34)cc(F)c1F)N=C(N)S2 |
| InChI | InChI=1S/C25H21F2N7O3S/c1-24(17-9-25(17,12-35-2)38-23(28)34-24)14-7-13(8-15(26)20(14)27)32-22-21-16(3-4-30-22)33-18(10-31-21)37-11-19-29-5-6-36-19/h3-10H,11-12H2,1-2H3,(H2,28,34)(H,30,32)/t24-,25-/m1/s1 |
| InChIKey | RVKXNRNLDMTHEG-JWQCQUIFSA-N |
| XLogP | 4.22 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|