C25H25F6N5O2S — CID 130435330
(4S,6R)-4-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine (PubChem CID 130435330) has the molecular formula C25H25F6N5O2S and a molecular weight of 573.56 g/mol. Its IUPAC name is (4S,6R)-4-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,6R)-4-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 130435330 |
| Molecular Formula | C25H25F6N5O2S |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | (4S,6R)-4-[2,3-difluoro-5-[[3-(2,2,3,3-tetrafluoropropoxy)-1,7-naphthyridin-8-yl]amino]phenyl]-6-(methoxymethyl)-4,6-dimethyl-5H-1,3-thiazin-2-amine |
| SMILES | COC[C@@]1(C)C[C@@](C)(c2cc(Nc3nccc4cc(OCC(F)(F)C(F)F)cnc34)cc(F)c2F)N=C(N)S1 |
| InChI | InChI=1S/C25H25F6N5O2S/c1-23(11-37-3)10-24(2,36-22(32)39-23)16-7-14(8-17(26)18(16)27)35-20-19-13(4-5-33-20)6-15(9-34-19)38-12-25(30,31)21(28)29/h4-9,21H,10-12H2,1-3H3,(H2,32,36)(H,33,35)/t23-,24+/m1/s1 |
| InChIKey | MORFVQSCTOCEAS-RPWUZVMVSA-N |
| XLogP | 6.00 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|