C22H20F2N6OS — CID 130435134
8-[3-[(4S,6R)-2-amino-6-(hydroxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile (PubChem CID 130435134) has the molecular formula C22H20F2N6OS and a molecular weight of 454.51 g/mol. Its IUPAC name is 8-[3-[(4S,6R)-2-amino-6-(hydroxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 8-[3-[(4S,6R)-2-amino-6-(hydroxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130435134 |
| Molecular Formula | C22H20F2N6OS |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 8-[3-[(4S,6R)-2-amino-6-(hydroxymethyl)-4,6-dimethyl-5H-1,3-thiazin-4-yl]-4,5-difluoroanilino]-1,7-naphthyridine-3-carbonitrile |
| SMILES | C[C@]1(CO)C[C@@](C)(c2cc(Nc3nccc4cc(C#N)cnc34)cc(F)c2F)N=C(N)S1 |
| InChI | InChI=1S/C22H20F2N6OS/c1-21(11-31)10-22(2,30-20(26)32-21)15-6-14(7-16(23)17(15)24)29-19-18-13(3-4-27-19)5-12(8-25)9-28-18/h3-7,9,31H,10-11H2,1-2H3,(H2,26,30)(H,27,29)/t21-,22+/m1/s1 |
| InChIKey | WBBNTUBWLCUFSW-YADHBBJMSA-N |
| XLogP | 3.94 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |