C23H21F2N7O2S — CID 126488504
(4S,6R)-2-amino-4-[2,3-difluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 126488504) has the molecular formula C23H21F2N7O2S and a molecular weight of 497.53 g/mol. Its IUPAC name is (4S,6R)-2-amino-4-[2,3-difluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,6R)-2-amino-4-[2,3-difluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 126488504 |
| Molecular Formula | C23H21F2N7O2S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (4S,6R)-2-amino-4-[2,3-difluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]-4,6-dimethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | C#CCOc1cnc2c(Nc3cc(F)c(F)c([C@]4(C)C[C@](C)(C(N)=O)SC(N)=N4)c3)ncnc2c1 |
| InChI | InChI=1S/C23H21F2N7O2S/c1-4-5-34-13-8-16-18(28-9-13)19(30-11-29-16)31-12-6-14(17(25)15(24)7-12)22(2)10-23(3,20(26)33)35-21(27)32-22/h1,6-9,11H,5,10H2,2-3H3,(H2,26,33)(H2,27,32)(H,29,30,31)/t22-,23+/m0/s1 |
| InChIKey | PZJUYJHOIKPNKB-XZOQPEGZSA-N |
| XLogP | 2.97 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|