C24H23F2N7O2S — CID 145015661
(4S,6R)-2-amino-4-(fluoromethyl)-4-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-N,6-dimethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 145015661) has the molecular formula C24H23F2N7O2S and a molecular weight of 511.56 g/mol. Its IUPAC name is (4S,6R)-2-amino-4-(fluoromethyl)-4-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-N,6-dimethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,6R)-2-amino-4-(fluoromethyl)-4-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-N,6-dimethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 145015661 |
| Molecular Formula | C24H23F2N7O2S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | (4S,6R)-2-amino-4-(fluoromethyl)-4-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-N,6-dimethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | C#CCOc1cnc2c(Nc3ccc(F)c([C@]4(CF)C[C@](C)(C(=O)NC)SC(N)=N4)c3)nccc2n1 |
| InChI | InChI=1S/C24H23F2N7O2S/c1-4-9-35-18-11-30-19-17(32-18)7-8-29-20(19)31-14-5-6-16(26)15(10-14)24(13-25)12-23(2,21(34)28-3)36-22(27)33-24/h1,5-8,10-11H,9,12-13H2,2-3H3,(H2,27,33)(H,28,34)(H,29,31)/t23-,24-/m1/s1 |
| InChIKey | JXUNVIDMXDWSQC-DNQXCXABSA-N |
| XLogP | 3.04 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|