C24H21F4N7O2S — CID 118866568
(1S,5R,6S)-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-3-pyridinyl]-5-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 118866568) has the molecular formula C24H21F4N7O2S and a molecular weight of 547.54 g/mol. Its IUPAC name is (1S,5R,6S)-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-3-pyridinyl]-5-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1S,5R,6S)-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-3-pyridinyl]-5-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 118866568 |
| Molecular Formula | C24H21F4N7O2S |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | (1S,5R,6S)-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-3-pyridinyl]-5-methyl-1-[(1R)-2,2,2-trifluoro-1-methoxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | C#CCOc1cnc2c(Nc3cnc(F)c([C@]4(C)N=C(N)S[C@@]5([C@H](OC)C(F)(F)F)C[C@H]54)c3)nccc2n1 |
| InChI | InChI=1S/C24H21F4N7O2S/c1-4-7-37-16-11-31-17-14(34-16)5-6-30-19(17)33-12-8-13(18(25)32-10-12)22(2)15-9-23(15,38-21(29)35-22)20(36-3)24(26,27)28/h1,5-6,8,10-11,15,20H,7,9H2,2-3H3,(H2,29,35)(H,30,33)/t15-,20-,22-,23-/m0/s1 |
| InChIKey | OBYYFAKATQRATL-PXDAIIFMSA-N |
| XLogP | 3.93 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|