C23H20F2N6O3S2 — CID 118866236
(1R,5R,6S)-5-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-1-methylsulfonyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 118866236) has the molecular formula C23H20F2N6O3S2 and a molecular weight of 530.58 g/mol. Its IUPAC name is (1R,5R,6S)-5-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-1-methylsulfonyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1R,5R,6S)-5-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-1-methylsulfonyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 118866236 |
| Molecular Formula | C23H20F2N6O3S2 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | (1R,5R,6S)-5-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-1-methylsulfonyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | C#CCOc1cnc2c(Nc3cc(F)c(F)c([C@]4(C)N=C(N)S[C@@]5(S(C)(=O)=O)C[C@@H]45)c3)nccc2n1 |
| InChI | InChI=1S/C23H20F2N6O3S2/c1-4-7-34-17-11-28-19-15(30-17)5-6-27-20(19)29-12-8-13(18(25)14(24)9-12)22(2)16-10-23(16,36(3,32)33)35-21(26)31-22/h1,5-6,8-9,11,16H,7,10H2,2-3H3,(H2,26,31)(H,27,29)/t16-,22-,23+/m0/s1 |
| InChIKey | JFFXUDFKLRIJQZ-IRBZQWRBSA-N |
| XLogP | 3.10 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|