C22H20F2N6OS — CID 145015677
(5S)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 145015677) has the molecular formula C22H20F2N6OS and a molecular weight of 454.51 g/mol. Its IUPAC name is (5S)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | (5S)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 145015677 |
| Molecular Formula | C22H20F2N6OS |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (5S)-4-[2,3-difluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5,6-dimethyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | C#CCOc1cnc2c(Nc3cc(F)c(F)c(C4N=C(N)SC(C)[C@H]4C)c3)nccc2n1 |
| InChI | InChI=1S/C22H20F2N6OS/c1-4-7-31-17-10-27-20-16(29-17)5-6-26-21(20)28-13-8-14(18(24)15(23)9-13)19-11(2)12(3)32-22(25)30-19/h1,5-6,8-12,19H,7H2,2-3H3,(H2,25,30)(H,26,28)/t11-,12?,19?/m1/s1 |
| InChIKey | VOPRRCPHDUBOOJ-KMXRQWDNSA-N |
| XLogP | 4.19 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|