C24H20F4N6O2S — CID 118866368
(1S)-1-[(1R,5S,6S)-3-amino-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]-2,2,2-trifluoroethanol (PubChem CID 118866368) has the molecular formula C24H20F4N6O2S and a molecular weight of 532.52 g/mol. Its IUPAC name is (1S)-1-[(1R,5S,6S)-3-amino-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]-2,2,2-trifluoroethanol.
| Compound Name | (1S)-1-[(1R,5S,6S)-3-amino-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 118866368 |
| Molecular Formula | C24H20F4N6O2S |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | (1S)-1-[(1R,5S,6S)-3-amino-5-[2-fluoro-5-[(2-prop-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]phenyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]-2,2,2-trifluoroethanol |
| SMILES | C#CCOc1cnc2c(Nc3ccc(F)c([C@@]4(C)N=C(N)S[C@]5([C@@H](O)C(F)(F)F)C[C@H]54)c3)nccc2n1 |
| InChI | InChI=1S/C24H20F4N6O2S/c1-3-8-36-17-11-31-18-15(33-17)6-7-30-19(18)32-12-4-5-14(25)13(9-12)22(2)16-10-23(16,37-21(29)34-22)20(35)24(26,27)28/h1,4-7,9,11,16,20,35H,8,10H2,2H3,(H2,29,34)(H,30,32)/t16-,20+,22+,23+/m0/s1 |
| InChIKey | CGPIMDKZFMGRBO-DQOBCGMHSA-N |
| XLogP | 3.88 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|