C23H20F4N4O3S — CID 158381383
2-[3-[(1S,5S,6S)-3-amino-5-methyl-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone (PubChem CID 158381383) has the molecular formula C23H20F4N4O3S and a molecular weight of 508.50 g/mol. Its IUPAC name is 2-[3-[(1S,5S,6S)-3-amino-5-methyl-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[3-[(1S,5S,6S)-3-amino-5-methyl-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 158381383 |
| Molecular Formula | C23H20F4N4O3S |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-[3-[(1S,5S,6S)-3-amino-5-methyl-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-2-thia-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
| SMILES | C#CCOc1cnc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)S[C@@]4([C@@H](O)C(F)(F)F)C[C@H]43)c2)cn1 |
| InChI | InChI=1S/C23H20F4N4O3S/c1-3-6-34-18-11-29-15(10-30-18)16(32)8-12-4-5-14(24)13(7-12)21(2)17-9-22(17,35-20(28)31-21)19(33)23(25,26)27/h1,4-5,7,10-11,17,19,33H,6,8-9H2,2H3,(H2,28,31)/t17-,19+,21+,22-/m0/s1 |
| InChIKey | GVVGCMWRPVDUDH-GWWHBBDRSA-N |
| XLogP | 3.01 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|