C24H21F3N6OS — CID 118866581
(1S,5S,6S)-5-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluorophenyl]-1,5-bis(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 118866581) has the molecular formula C24H21F3N6OS and a molecular weight of 498.53 g/mol. Its IUPAC name is (1S,5S,6S)-5-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluorophenyl]-1,5-bis(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1S,5S,6S)-5-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluorophenyl]-1,5-bis(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 118866581 |
| Molecular Formula | C24H21F3N6OS |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (1S,5S,6S)-5-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluorophenyl]-1,5-bis(fluoromethyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | CC#CCOc1cnc2c(Nc3ccc(F)c([C@@]4(CF)N=C(N)S[C@@]5(CF)C[C@H]54)c3)nccc2n1 |
| InChI | InChI=1S/C24H21F3N6OS/c1-2-3-8-34-19-11-30-20-17(32-19)6-7-29-21(20)31-14-4-5-16(27)15(9-14)24(13-26)18-10-23(18,12-25)35-22(28)33-24/h4-7,9,11,18H,8,10,12-13H2,1H3,(H2,28,33)(H,29,31)/t18-,23-,24-/m1/s1 |
| InChIKey | URYGNWAQODMINB-DQMJNTIXSA-N |
| XLogP | 4.26 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|