C24H24FN7O3S — CID 144972687
(3R,6S)-3-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-6-ethenyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 144972687) has the molecular formula C24H24FN7O3S and a molecular weight of 509.57 g/mol. Its IUPAC name is (3R,6S)-3-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-6-ethenyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-6-ethenyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 144972687 |
| Molecular Formula | C24H24FN7O3S |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (3R,6S)-3-[5-[(2-but-2-ynoxypyrido[3,4-b]pyrazin-5-yl)amino]-2-fluoro-3-pyridinyl]-6-ethenyl-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | C=C[C@@]1(C)C(N)=N[C@](C)(c2cc(Nc3nccc4nc(OCC#CC)cnc34)cnc2F)CS1(=O)=O |
| InChI | InChI=1S/C24H24FN7O3S/c1-5-7-10-35-18-13-28-19-17(31-18)8-9-27-21(19)30-15-11-16(20(25)29-12-15)23(3)14-36(33,34)24(4,6-2)22(26)32-23/h6,8-9,11-13H,2,10,14H2,1,3-4H3,(H2,26,32)(H,27,30)/t23-,24-/m0/s1 |
| InChIKey | QSHOEXUDYQKTGZ-ZEQRLZLVSA-N |
| XLogP | 2.65 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|