C24H25FN6O3S — CID 144972593
(3R)-3-[2-[(3-but-2-ynoxy-1,7-naphthyridin-8-yl)amino]-5-fluoro-4-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 144972593) has the molecular formula C24H25FN6O3S and a molecular weight of 496.57 g/mol. Its IUPAC name is (3R)-3-[2-[(3-but-2-ynoxy-1,7-naphthyridin-8-yl)amino]-5-fluoro-4-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[2-[(3-but-2-ynoxy-1,7-naphthyridin-8-yl)amino]-5-fluoro-4-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 144972593 |
| Molecular Formula | C24H25FN6O3S |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (3R)-3-[2-[(3-but-2-ynoxy-1,7-naphthyridin-8-yl)amino]-5-fluoro-4-pyridinyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC#CCOc1cnc2c(Nc3cc([C@]4(C)CS(=O)(=O)C(C)(C)C(N)=N4)c(F)cn3)nccc2c1 |
| InChI | InChI=1S/C24H25FN6O3S/c1-5-6-9-34-16-10-15-7-8-27-21(20(15)29-12-16)30-19-11-17(18(25)13-28-19)24(4)14-35(32,33)23(2,3)22(26)31-24/h7-8,10-13H,9,14H2,1-4H3,(H2,26,31)(H,27,28,30)/t24-/m0/s1 |
| InChIKey | HTNAUXXEFHYOAN-DEOSSOPVSA-N |
| XLogP | 3.09 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|