C20H21FN6O3S — CID 144972609
3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-3-pyridinyl]-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-5-amine (PubChem CID 144972609) has the molecular formula C20H21FN6O3S and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-3-pyridinyl]-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-5-amine.
| Compound Name | 3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-3-pyridinyl]-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 144972609 |
| Molecular Formula | C20H21FN6O3S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-3-pyridinyl]-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-5-amine |
| SMILES | COc1cnc2c(Nc3cnc(F)c(C4CS(=O)(=O)C(C)(C)C(N)=N4)c3)nccc2c1 |
| InChI | InChI=1S/C20H21FN6O3S/c1-20(2)19(22)27-15(10-31(20,28)29)14-7-12(8-25-17(14)21)26-18-16-11(4-5-23-18)6-13(30-3)9-24-16/h4-9,15H,10H2,1-3H3,(H2,22,27)(H,23,26) |
| InChIKey | OJHHUAYYBWNHIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|