C10H11N3O — CID 118359512
3-methoxy-N-methyl-1,7-naphthyridin-8-amine (PubChem CID 118359512) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 3-methoxy-N-methyl-1,7-naphthyridin-8-amine.
| Compound Name | 3-methoxy-N-methyl-1,7-naphthyridin-8-amine |
|---|---|
| PubChem CID | 118359512 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 3-methoxy-N-methyl-1,7-naphthyridin-8-amine |
| SMILES | CNc1nccc2cc(OC)cnc12 |
| InChI | InChI=1S/C10H11N3O/c1-11-10-9-7(3-4-12-10)5-8(14-2)6-13-9/h3-6H,1-2H3,(H,11,12) |
| InChIKey | PFZFXNPHURIBDS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |