About 8-bromo-3-methoxy-1,7-naphthyridine
8-bromo-3-methoxy-1,7-naphthyridine (PubChem CID 118568271) has the molecular formula C9H7BrN2O
and a molecular weight of 239.07 g/mol. Its IUPAC name is 8-bromo-3-methoxy-1,7-naphthyridine.
Molecular Properties
| Compound Name | 8-bromo-3-methoxy-1,7-naphthyridine |
| PubChem CID | 118568271 |
| Molecular Formula | C9H7BrN2O |
| Molecular Weight | 239.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 8-bromo-3-methoxy-1,7-naphthyridine |
| SMILES | COc1cnc2c(Br)nccc2c1 |
| InChI | InChI=1S/C9H7BrN2O/c1-13-7-4-6-2-3-11-9(10)8(6)12-5-7/h2-5H,1H3 |
| InChIKey | WCWRYIHKMDTLEC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.07 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-3-methoxy-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-methoxy-1,7-naphthyridine?
The IUPAC name of 8-bromo-3-methoxy-1,7-naphthyridine (CID 118568271) is 8-bromo-3-methoxy-1,7-naphthyridine.
What is the SMILES notation for 8-bromo-3-methoxy-1,7-naphthyridine?
The canonical SMILES for 8-bromo-3-methoxy-1,7-naphthyridine is COc1cnc2c(Br)nccc2c1.
What is the InChIKey of 8-bromo-3-methoxy-1,7-naphthyridine?
The InChIKey is WCWRYIHKMDTLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O/c1-13-7-4-6-2-3-11-9(10)8(6)12-5-7/h2-5H,1H3.
What are the key properties of 8-bromo-3-methoxy-1,7-naphthyridine?
8-bromo-3-methoxy-1,7-naphthyridine has a molecular weight of 239.07 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-methoxy-1,7-naphthyridine is sourced from PubChem (CID 118568271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).