C22H20F3N7S — CID 126488451
8-[[5-[(4S,5S,6S)-2-amino-6-(difluoromethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-6-fluoro-3-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile (PubChem CID 126488451) has the molecular formula C22H20F3N7S and a molecular weight of 471.51 g/mol. Its IUPAC name is 8-[[5-[(4S,5S,6S)-2-amino-6-(difluoromethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-6-fluoro-3-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 8-[[5-[(4S,5S,6S)-2-amino-6-(difluoromethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-6-fluoro-3-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 126488451 |
| Molecular Formula | C22H20F3N7S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 8-[[5-[(4S,5S,6S)-2-amino-6-(difluoromethyl)-4,5,6-trimethyl-5H-1,3-thiazin-4-yl]-6-fluoro-3-pyridinyl]amino]-1,7-naphthyridine-3-carbonitrile |
| SMILES | C[C@H]1[C@@](C)(c2cc(Nc3nccc4cc(C#N)cnc34)cnc2F)N=C(N)S[C@]1(C)C(F)F |
| InChI | InChI=1S/C22H20F3N7S/c1-11-21(2,32-20(27)33-22(11,3)19(24)25)15-7-14(10-30-17(15)23)31-18-16-13(4-5-28-18)6-12(8-26)9-29-16/h4-7,9-11,19H,1-3H3,(H2,27,32)(H,28,31)/t11-,21-,22-/m0/s1 |
| InChIKey | NZULBEPKISYJAS-FSYBCHNYSA-N |
| XLogP | 4.72 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|