C24H20F3N7O3S — CID 118866199
[(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]amino]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol (PubChem CID 118866199) has the molecular formula C24H20F3N7O3S and a molecular weight of 543.53 g/mol. Its IUPAC name is [(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]amino]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol.
| Compound Name | [(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]amino]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 118866199 |
| Molecular Formula | C24H20F3N7O3S |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | [(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]amino]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol |
| SMILES | C[C@]1(c2cc(Nc3nccc4cc(OCc5ncco5)cnc34)cnc2F)N=C(N)S[C@]2(CO)[C@H]1C2(F)F |
| InChI | InChI=1S/C24H20F3N7O3S/c1-22(20-23(11-35,24(20,26)27)38-21(28)34-22)15-7-13(8-32-18(15)25)33-19-17-12(2-3-30-19)6-14(9-31-17)37-10-16-29-4-5-36-16/h2-9,20,35H,10-11H2,1H3,(H2,28,34)(H,30,33)/t20-,22+,23+/m0/s1 |
| InChIKey | XAYORRXBDKANGZ-MDNUFGMLSA-N |
| XLogP | 3.75 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|