C26H26F2N8O3S — CID 126487659
(4S,6R)-2-amino-4-[2,3-difluoro-5-[[7-(1,3-oxazol-2-ylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-N,N,4,6-tetramethyl-5H-1,3-thiazine-6-carboxamide (PubChem CID 126487659) has the molecular formula C26H26F2N8O3S and a molecular weight of 568.61 g/mol. Its IUPAC name is (4S,6R)-2-amino-4-[2,3-difluoro-5-[[7-(1,3-oxazol-2-ylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-N,N,4,6-tetramethyl-5H-1,3-thiazine-6-carboxamide.
| Compound Name | (4S,6R)-2-amino-4-[2,3-difluoro-5-[[7-(1,3-oxazol-2-ylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-N,N,4,6-tetramethyl-5H-1,3-thiazine-6-carboxamide |
|---|---|
| PubChem CID | 126487659 |
| Molecular Formula | C26H26F2N8O3S |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | (4S,6R)-2-amino-4-[2,3-difluoro-5-[[7-(1,3-oxazol-2-ylmethoxy)pyrido[3,2-d]pyrimidin-4-yl]amino]phenyl]-N,N,4,6-tetramethyl-5H-1,3-thiazine-6-carboxamide |
| SMILES | CN(C)C(=O)[C@@]1(C)C[C@@](C)(c2cc(Nc3ncnc4cc(OCc5ncco5)cnc34)cc(F)c2F)N=C(N)S1 |
| InChI | InChI=1S/C26H26F2N8O3S/c1-25(12-26(2,23(37)36(3)4)40-24(29)35-25)16-7-14(8-17(27)20(16)28)34-22-21-18(32-13-33-22)9-15(10-31-21)39-11-19-30-5-6-38-19/h5-10,13H,11-12H2,1-4H3,(H2,29,35)(H,32,33,34)/t25-,26+/m0/s1 |
| InChIKey | MTBZZPWAFPXVFT-IZZNHLLZSA-N |
| XLogP | 4.13 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |