C25H21F3N6O3S — CID 158477642
[(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]methyl]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol (PubChem CID 158477642) has the molecular formula C25H21F3N6O3S and a molecular weight of 542.54 g/mol. Its IUPAC name is [(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]methyl]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol.
| Compound Name | [(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]methyl]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 158477642 |
| Molecular Formula | C25H21F3N6O3S |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | [(1S,5S,6R)-3-amino-7,7-difluoro-5-[2-fluoro-5-[[3-(1,3-oxazol-2-ylmethoxy)-1,7-naphthyridin-8-yl]methyl]-3-pyridinyl]-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-en-1-yl]methanol |
| SMILES | C[C@]1(c2cc(Cc3nccc4cc(OCc5ncco5)cnc34)cnc2F)N=C(N)S[C@]2(CO)[C@H]1C2(F)F |
| InChI | InChI=1S/C25H21F3N6O3S/c1-23(21-24(12-35,25(21,27)28)38-22(29)34-23)16-6-13(9-33-20(16)26)7-17-19-14(2-3-30-17)8-15(10-32-19)37-11-18-31-4-5-36-18/h2-6,8-10,21,35H,7,11-12H2,1H3,(H2,29,34)/t21-,23+,24+/m0/s1 |
| InChIKey | HHCZPJUOSYSABN-QPTUXGOLSA-N |
| XLogP | 3.59 |
| TPSA | 132.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|