C23H27FN6O2S — CID 130404510
(1S,3R)-3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 130404510) has the molecular formula C23H27FN6O2S and a molecular weight of 470.57 g/mol. Its IUPAC name is (1S,3R)-3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (1S,3R)-3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 130404510 |
| Molecular Formula | C23H27FN6O2S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (1S,3R)-3-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | CN=[S@]1(=O)C[C@@](C)(c2cc(Nc3nccc4cc(OC)cnc34)ccc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C23H27FN6O2S/c1-22(2)21(25)30-23(3,13-33(22,31)26-4)17-11-15(6-7-18(17)24)29-20-19-14(8-9-27-20)10-16(32-5)12-28-19/h6-12H,13H2,1-5H3,(H2,25,30)(H,27,29)/t23-,33-/m0/s1 |
| InChIKey | GQZUQSCKXXTDPB-WYOOIXGGSA-N |
| XLogP | 3.98 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |