C24H18ClFN6O2S — CID 118468825
(4S)-3'-chloro-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine (PubChem CID 118468825) has the molecular formula C24H18ClFN6O2S and a molecular weight of 508.97 g/mol. Its IUPAC name is (4S)-3'-chloro-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine.
| Compound Name | (4S)-3'-chloro-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine |
|---|---|
| PubChem CID | 118468825 |
| Molecular Formula | C24H18ClFN6O2S |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | (4S)-3'-chloro-1'-fluoro-7-N'-(3-methoxy-1,7-naphthyridin-8-yl)spiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine |
| SMILES | COc1cnc2c(Nc3ccc4c(c3)[C@@]3(CCSC(N)=N3)c3cc(Cl)nc(F)c3O4)nccc2c1 |
| InChI | InChI=1S/C24H18ClFN6O2S/c1-33-14-8-12-4-6-28-22(19(12)29-11-14)30-13-2-3-17-15(9-13)24(5-7-35-23(27)32-24)16-10-18(25)31-21(26)20(16)34-17/h2-4,6,8-11H,5,7H2,1H3,(H2,27,32)(H,28,30)/t24-/m0/s1 |
| InChIKey | XRSJVIJHQBZZBH-DEOSSOPVSA-N |
| XLogP | 5.37 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|