C30H27FN6O3S — CID 123513602
3'-(3,6-dihydro-2H-pyran-5-yl)-7-N'-(3-ethoxy-1,7-naphthyridin-8-yl)-1'-fluorospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine (PubChem CID 123513602) has the molecular formula C30H27FN6O3S and a molecular weight of 570.65 g/mol. Its IUPAC name is 3'-(3,6-dihydro-2H-pyran-5-yl)-7-N'-(3-ethoxy-1,7-naphthyridin-8-yl)-1'-fluorospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine.
| Compound Name | 3'-(3,6-dihydro-2H-pyran-5-yl)-7-N'-(3-ethoxy-1,7-naphthyridin-8-yl)-1'-fluorospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine |
|---|---|
| PubChem CID | 123513602 |
| Molecular Formula | C30H27FN6O3S |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 3'-(3,6-dihydro-2H-pyran-5-yl)-7-N'-(3-ethoxy-1,7-naphthyridin-8-yl)-1'-fluorospiro[5,6-dihydro-1,3-thiazine-4,5'-chromeno[2,3-c]pyridine]-2,7'-diamine |
| SMILES | CCOc1cnc2c(Nc3ccc4c(c3)C3(CCSC(N)=N3)c3cc(C5=CCCOC5)nc(F)c3O4)nccc2c1 |
| InChI | InChI=1S/C30H27FN6O3S/c1-2-39-20-12-17-7-9-33-28(25(17)34-15-20)35-19-5-6-24-21(13-19)30(8-11-41-29(32)37-30)22-14-23(18-4-3-10-38-16-18)36-27(31)26(22)40-24/h4-7,9,12-15H,2-3,8,10-11,16H2,1H3,(H2,32,37)(H,33,35) |
| InChIKey | SIUBVPJWYVSGOR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|