C19H20F2N4O4S — CID 126634332
N-[3-[(3R)-5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl]-4,5-difluorophenyl]-5-methoxypyridine-2-carboxamide (PubChem CID 126634332) has the molecular formula C19H20F2N4O4S and a molecular weight of 438.46 g/mol. Its IUPAC name is N-[3-[(3R)-5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl]-4,5-difluorophenyl]-5-methoxypyridine-2-carboxamide.
| Compound Name | N-[3-[(3R)-5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl]-4,5-difluorophenyl]-5-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 126634332 |
| Molecular Formula | C19H20F2N4O4S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[3-[(3R)-5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl]-4,5-difluorophenyl]-5-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cc(F)c(F)c([C@@H]3CS(=O)(=O)C(C)(C)C(N)=N3)c2)nc1 |
| InChI | InChI=1S/C19H20F2N4O4S/c1-19(2)18(22)25-15(9-30(19,27)28)12-6-10(7-13(20)16(12)21)24-17(26)14-5-4-11(29-3)8-23-14/h4-8,15H,9H2,1-3H3,(H2,22,25)(H,24,26)/t15-/m0/s1 |
| InChIKey | HNCJAQVJGMVECC-HNNXBMFYSA-N |
| XLogP | 2.23 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |