C18H21FN4O4S — CID 138495197
N-[3-(5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl)-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 138495197) has the molecular formula C18H21FN4O4S and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[3-(5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl)-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-(5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl)-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 138495197 |
| Molecular Formula | C18H21FN4O4S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[3-(5-amino-6,6-dimethyl-1,1-dioxo-2,3-dihydro-1,4-thiazin-3-yl)-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(F)c(C3CS(=O)(=O)C(C)(C)C(N)=N3)c2)c(C)o1 |
| InChI | InChI=1S/C18H21FN4O4S/c1-9-15(21-10(2)27-9)16(24)22-11-5-6-13(19)12(7-11)14-8-28(25,26)18(3,4)17(20)23-14/h5-7,14H,8H2,1-4H3,(H2,20,23)(H,22,24) |
| InChIKey | DXBXIJYXMQVEMV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |