C18H23FN6OS — CID 146531534
N-[3-[(4R)-6-amino-2,7,7-trimethyl-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 146531534) has the molecular formula C18H23FN6OS and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[3-[(4R)-6-amino-2,7,7-trimethyl-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[(4R)-6-amino-2,7,7-trimethyl-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146531534 |
| Molecular Formula | C18H23FN6OS |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[3-[(4R)-6-amino-2,7,7-trimethyl-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | CN1C[C@@H](c2cc(NC(=O)c3ccn(C)n3)ccc2F)N=C(N)C(C)(C)S1 |
| InChI | InChI=1S/C18H23FN6OS/c1-18(2)17(20)22-15(10-25(4)27-18)12-9-11(5-6-13(12)19)21-16(26)14-7-8-24(3)23-14/h5-9,15H,10H2,1-4H3,(H2,20,22)(H,21,26)/t15-/m0/s1 |
| InChIKey | FHEPYNFYCPYIFN-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|