C20H21FN6O3S — CID 155543145
N-[3-[(4R)-6-amino-2,7,7-trimethyl-1,1-dioxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide (PubChem CID 155543145) has the molecular formula C20H21FN6O3S and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[3-[(4R)-6-amino-2,7,7-trimethyl-1,1-dioxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[3-[(4R)-6-amino-2,7,7-trimethyl-1,1-dioxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 155543145 |
| Molecular Formula | C20H21FN6O3S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[3-[(4R)-6-amino-2,7,7-trimethyl-1,1-dioxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl]-4-fluorophenyl]-5-cyanopyridine-2-carboxamide |
| SMILES | CN1C[C@@H](c2cc(NC(=O)c3ccc(C#N)cn3)ccc2F)N=C(N)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C20H21FN6O3S/c1-20(2)19(23)26-17(11-27(3)31(20,29)30)14-8-13(5-6-15(14)21)25-18(28)16-7-4-12(9-22)10-24-16/h4-8,10,17H,11H2,1-3H3,(H2,23,26)(H,25,28)/t17-/m0/s1 |
| InChIKey | HFDVQFLUUCLMRC-KRWDZBQOSA-N |
| XLogP | 1.80 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |