C14H10FN3O — CID 63716731
5-cyano-N-(4-fluoro-3-methylphenyl)pyridine-2-carboxamide (PubChem CID 63716731) has the molecular formula C14H10FN3O and a molecular weight of 255.25 g/mol. Its IUPAC name is 5-cyano-N-(4-fluoro-3-methylphenyl)pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-(4-fluoro-3-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63716731 |
| Molecular Formula | C14H10FN3O |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-cyano-N-(4-fluoro-3-methylphenyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(C#N)cn2)ccc1F |
| InChI | InChI=1S/C14H10FN3O/c1-9-6-11(3-4-12(9)15)18-14(19)13-5-2-10(7-16)8-17-13/h2-6,8H,1H3,(H,18,19) |
| InChIKey | OYDUSOJBQAQPSI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |