C15H13N3O3 — CID 63716894
5-cyano-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide (PubChem CID 63716894) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 5-cyano-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63716894 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-cyano-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2ccc(C#N)cn2)cc(OC)c1 |
| InChI | InChI=1S/C15H13N3O3/c1-20-12-5-11(6-13(7-12)21-2)18-15(19)14-4-3-10(8-16)9-17-14/h3-7,9H,1-2H3,(H,18,19) |
| InChIKey | XHUZDDVAMWZBEE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |