C19H22FN5O4S — CID 118190073
N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 118190073) has the molecular formula C19H22FN5O4S and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118190073 |
| Molecular Formula | C19H22FN5O4S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(F)c([C@@]3(C)N=C(N)N(C)S(=O)(=O)C34CC4)c2)c(C)o1 |
| InChI | InChI=1S/C19H22FN5O4S/c1-10-15(22-11(2)29-10)16(26)23-12-5-6-14(20)13(9-12)18(3)19(7-8-19)30(27,28)25(4)17(21)24-18/h5-6,9H,7-8H2,1-4H3,(H2,21,24)(H,23,26)/t18-/m1/s1 |
| InChIKey | TVCGECNZTOJGPF-GOSISDBHSA-N |
| XLogP | 2.02 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |