C19H21FN4O3S — CID 144762667
N-[3-[(4aS,7aR)-2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 144762667) has the molecular formula C19H21FN4O3S and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[3-[(4aS,7aR)-2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[(4aS,7aR)-2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 144762667 |
| Molecular Formula | C19H21FN4O3S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[3-[(4aS,7aR)-2-amino-4a-methyl-5,7-dihydro-4H-furo[3,4-d][1,3]thiazin-7a-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(F)c([C@]34COC[C@@]3(C)CSC(N)=N4)c2)c(C)o1 |
| InChI | InChI=1S/C19H21FN4O3S/c1-10-15(22-11(2)27-10)16(25)23-12-4-5-14(20)13(6-12)19-8-26-7-18(19,3)9-28-17(21)24-19/h4-6H,7-9H2,1-3H3,(H2,21,24)(H,23,25)/t18-,19+/m0/s1 |
| InChIKey | OMJXVERRXVSIAM-RBUKOAKNSA-N |
| XLogP | 2.98 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |