C19H20F4N4O2 — CID 118307972
N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 118307972) has the molecular formula C19H20F4N4O2 and a molecular weight of 412.39 g/mol. Its IUPAC name is N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118307972 |
| Molecular Formula | C19H20F4N4O2 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(F)c([C@@]3(C)N=C(N)[C@@](C)(F)CC3(F)F)c2)c(C)o1 |
| InChI | InChI=1S/C19H20F4N4O2/c1-9-14(25-10(2)29-9)15(28)26-11-5-6-13(20)12(7-11)18(4)19(22,23)8-17(3,21)16(24)27-18/h5-7H,8H2,1-4H3,(H2,24,27)(H,26,28)/t17-,18+/m0/s1 |
| InChIKey | ANSIAVPOQGVLFC-ZWKOTPCHSA-N |
| XLogP | 4.02 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |