C18H18F4N4O2 — CID 118307941
N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 118307941) has the molecular formula C18H18F4N4O2 and a molecular weight of 398.36 g/mol. Its IUPAC name is N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 118307941 |
| Molecular Formula | C18H18F4N4O2 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(F)c([C@@]3(C)N=C(N)[C@@](C)(F)CC3(F)F)c2)co1 |
| InChI | InChI=1S/C18H18F4N4O2/c1-9-24-13(7-28-9)14(27)25-10-4-5-12(19)11(6-10)17(3)18(21,22)8-16(2,20)15(23)26-17/h4-7H,8H2,1-3H3,(H2,23,26)(H,25,27)/t16-,17+/m0/s1 |
| InChIKey | UFLNEUNQYILWEH-DLBZAZTESA-N |
| XLogP | 3.71 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |