C16H18ClN5O4S — CID 51352360
N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorophenyl]-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 51352360) has the molecular formula C16H18ClN5O4S and a molecular weight of 411.87 g/mol. Its IUPAC name is N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorophenyl]-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorophenyl]-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 51352360 |
| Molecular Formula | C16H18ClN5O4S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-chlorophenyl]-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(Cl)c([C@]3(C)CS(=O)(=O)N(C)C(N)=N3)c2)co1 |
| InChI | InChI=1S/C16H18ClN5O4S/c1-9-19-13(7-26-9)14(23)20-10-4-5-12(17)11(6-10)16(2)8-27(24,25)22(3)15(18)21-16/h4-7H,8H2,1-3H3,(H2,18,21)(H,20,23)/t16-/m0/s1 |
| InChIKey | RBKOAQIBOCUSRB-INIZCTEOSA-N |
| XLogP | 1.69 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |