C19H17ClFN5O4S — CID 175310985
N-[3-(3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl)-4-fluorophenyl]-5-chloro-1,3-benzoxazole-2-carboxamide (PubChem CID 175310985) has the molecular formula C19H17ClFN5O4S and a molecular weight of 465.89 g/mol. Its IUPAC name is N-[3-(3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl)-4-fluorophenyl]-5-chloro-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-[3-(3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl)-4-fluorophenyl]-5-chloro-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 175310985 |
| Molecular Formula | C19H17ClFN5O4S |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[3-(3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl)-4-fluorophenyl]-5-chloro-1,3-benzoxazole-2-carboxamide |
| SMILES | CN1C(N)=NC(C)(c2cc(NC(=O)c3nc4cc(Cl)ccc4o3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H17ClFN5O4S/c1-19(9-31(28,29)26(2)18(22)25-19)12-8-11(4-5-13(12)21)23-16(27)17-24-14-7-10(20)3-6-15(14)30-17/h3-8H,9H2,1-2H3,(H2,22,25)(H,23,27) |
| InChIKey | VSJRIKYPOCMSRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |