C17H16ClF2N5O3S — CID 51352404
N-[5-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 51352404) has the molecular formula C17H16ClF2N5O3S and a molecular weight of 443.86 g/mol. Its IUPAC name is N-[5-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[5-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 51352404 |
| Molecular Formula | C17H16ClF2N5O3S |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[5-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4-difluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@](C)(c2cc(NC(=O)c3ccc(Cl)cn3)c(F)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C17H16ClF2N5O3S/c1-17(8-29(27,28)25(2)16(21)24-17)10-5-14(12(20)6-11(10)19)23-15(26)13-4-3-9(18)7-22-13/h3-7H,8H2,1-2H3,(H2,21,24)(H,23,26)/t17-/m0/s1 |
| InChIKey | SENWNSUNNAJVCK-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |