C17H15ClF3N5O3S — CID 88594219
N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-chloropyridine-2-carboxamide (PubChem CID 88594219) has the molecular formula C17H15ClF3N5O3S and a molecular weight of 461.85 g/mol. Its IUPAC name is N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 88594219 |
| Molecular Formula | C17H15ClF3N5O3S |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-2,4,5-trifluorophenyl]-5-chloropyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@](C)(c2c(F)c(F)cc(NC(=O)c3ccc(Cl)cn3)c2F)CS1(=O)=O |
| InChI | InChI=1S/C17H15ClF3N5O3S/c1-17(7-30(28,29)26(2)16(22)25-17)12-13(20)9(19)5-11(14(12)21)24-15(27)10-4-3-8(18)6-23-10/h3-6H,7H2,1-2H3,(H2,22,25)(H,24,27)/t17-/m0/s1 |
| InChIKey | MFEMLJBQVXODLA-KRWDZBQOSA-N |
| XLogP | 2.21 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|