C20H20FN5O5S — CID 175311031
N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-6-methoxy-1,3-benzoxazole-2-carboxamide (PubChem CID 175311031) has the molecular formula C20H20FN5O5S and a molecular weight of 461.48 g/mol. Its IUPAC name is N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-6-methoxy-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-6-methoxy-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 175311031 |
| Molecular Formula | C20H20FN5O5S |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[3-[(5R)-3-amino-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-5-yl]-4-fluorophenyl]-6-methoxy-1,3-benzoxazole-2-carboxamide |
| SMILES | COc1ccc2nc(C(=O)Nc3ccc(F)c([C@]4(C)CS(=O)(=O)N(C)C(N)=N4)c3)oc2c1 |
| InChI | InChI=1S/C20H20FN5O5S/c1-20(10-32(28,29)26(2)19(22)25-20)13-8-11(4-6-14(13)21)23-17(27)18-24-15-7-5-12(30-3)9-16(15)31-18/h4-9H,10H2,1-3H3,(H2,22,25)(H,23,27)/t20-/m0/s1 |
| InChIKey | PXZWWHZTJRCIQV-FQEVSTJZSA-N |
| XLogP | 2.03 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |