C18H18F4N4O2 — CID 159098774
2-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone (PubChem CID 159098774) has the molecular formula C18H18F4N4O2 and a molecular weight of 398.36 g/mol. Its IUPAC name is 2-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone.
| Compound Name | 2-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 159098774 |
| Molecular Formula | C18H18F4N4O2 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[3-[(2R,5S)-6-amino-3,3,5-trifluoro-2,5-dimethyl-4H-pyridin-2-yl]-4-fluorophenyl]-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethanone |
| SMILES | Cc1nnc(C(=O)Cc2ccc(F)c([C@@]3(C)N=C(N)[C@@](C)(F)CC3(F)F)c2)o1 |
| InChI | InChI=1S/C18H18F4N4O2/c1-9-25-26-14(28-9)13(27)7-10-4-5-12(19)11(6-10)17(3)18(21,22)8-16(2,20)15(23)24-17/h4-6H,7-8H2,1-3H3,(H2,23,24)/t16-,17+/m0/s1 |
| InChIKey | KCZWAMMLLPCWBP-DLBZAZTESA-N |
| XLogP | 3.28 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |