C16H17FN6O3S2 — CID 123827943
N-[3-(6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl)-4-fluorophenyl]-1,2,5-thiadiazole-3-carboxamide (PubChem CID 123827943) has the molecular formula C16H17FN6O3S2 and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[3-(6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl)-4-fluorophenyl]-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[3-(6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl)-4-fluorophenyl]-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 123827943 |
| Molecular Formula | C16H17FN6O3S2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-[3-(6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl)-4-fluorophenyl]-1,2,5-thiadiazole-3-carboxamide |
| SMILES | CN1C(N)=NC(C)(c2cc(NC(=O)c3cnsn3)ccc2F)C2(CC2)S1(=O)=O |
| InChI | InChI=1S/C16H17FN6O3S2/c1-15(16(5-6-16)28(25,26)23(2)14(18)21-15)10-7-9(3-4-11(10)17)20-13(24)12-8-19-27-22-12/h3-4,7-8H,5-6H2,1-2H3,(H2,18,21)(H,20,24) |
| InChIKey | WOHKSIPTWIJLRL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |