C9H7FN4OS — CID 62058615
N-(3-amino-4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide (PubChem CID 62058615) has the molecular formula C9H7FN4OS and a molecular weight of 238.25 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 62058615 |
| Molecular Formula | C9H7FN4OS |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-1,2,5-thiadiazole-3-carboxamide |
| SMILES | Nc1cc(NC(=O)c2cnsn2)ccc1F |
| InChI | InChI=1S/C9H7FN4OS/c10-6-2-1-5(3-7(6)11)13-9(15)8-4-12-16-14-8/h1-4H,11H2,(H,13,15) |
| InChIKey | LQYLHKZVZFXDGZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|