C22H21F2N7OS — CID 126487722
(4S,6R)-6-(fluoromethyl)-4-[2-fluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]-3-pyridinyl]-4,6-dimethyl-5H-1,3-thiazin-2-amine (PubChem CID 126487722) has the molecular formula C22H21F2N7OS and a molecular weight of 469.52 g/mol. Its IUPAC name is (4S,6R)-6-(fluoromethyl)-4-[2-fluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]-3-pyridinyl]-4,6-dimethyl-5H-1,3-thiazin-2-amine.
| Compound Name | (4S,6R)-6-(fluoromethyl)-4-[2-fluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]-3-pyridinyl]-4,6-dimethyl-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 126487722 |
| Molecular Formula | C22H21F2N7OS |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (4S,6R)-6-(fluoromethyl)-4-[2-fluoro-5-[(7-prop-2-ynoxypyrido[3,2-d]pyrimidin-4-yl)amino]-3-pyridinyl]-4,6-dimethyl-5H-1,3-thiazin-2-amine |
| SMILES | C#CCOc1cnc2c(Nc3cnc(F)c([C@]4(C)C[C@](C)(CF)SC(N)=N4)c3)ncnc2c1 |
| InChI | InChI=1S/C22H21F2N7OS/c1-4-5-32-14-7-16-17(26-9-14)19(29-12-28-16)30-13-6-15(18(24)27-8-13)22(3)10-21(2,11-23)33-20(25)31-22/h1,6-9,12H,5,10-11H2,2-3H3,(H2,25,31)(H,28,29,30)/t21-,22+/m1/s1 |
| InChIKey | JTAYCSLPLVXQQN-YADHBBJMSA-N |
| XLogP | 3.71 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|