C22H20ClF3N4O — CID 118242006
N-[3-[(3S,4R)-6-amino-4-(fluoromethyl)-2,3-dimethyl-2,3-dihydropyran-4-yl]-4,5-difluorophenyl]-3-chloro-1,7-naphthyridin-8-amine (PubChem CID 118242006) has the molecular formula C22H20ClF3N4O and a molecular weight of 448.88 g/mol. Its IUPAC name is N-[3-[(3S,4R)-6-amino-4-(fluoromethyl)-2,3-dimethyl-2,3-dihydropyran-4-yl]-4,5-difluorophenyl]-3-chloro-1,7-naphthyridin-8-amine.
| Compound Name | N-[3-[(3S,4R)-6-amino-4-(fluoromethyl)-2,3-dimethyl-2,3-dihydropyran-4-yl]-4,5-difluorophenyl]-3-chloro-1,7-naphthyridin-8-amine |
|---|---|
| PubChem CID | 118242006 |
| Molecular Formula | C22H20ClF3N4O |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[3-[(3S,4R)-6-amino-4-(fluoromethyl)-2,3-dimethyl-2,3-dihydropyran-4-yl]-4,5-difluorophenyl]-3-chloro-1,7-naphthyridin-8-amine |
| SMILES | CC1OC(N)=C[C@@](CF)(c2cc(Nc3nccc4cc(Cl)cnc34)cc(F)c2F)[C@@H]1C |
| InChI | InChI=1S/C22H20ClF3N4O/c1-11-12(2)31-18(27)8-22(11,10-24)16-6-15(7-17(25)19(16)26)30-21-20-13(3-4-28-21)5-14(23)9-29-20/h3-9,11-12H,10,27H2,1-2H3,(H,28,30)/t11-,12?,22+/m1/s1 |
| InChIKey | RYFHSDPGEHFAEY-HFXDMHSLSA-N |
| XLogP | 5.37 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |