About CID 160529153
CID 160529153 (PubChem CID 160529153) has the molecular formula C29H33ClN2O6
and a molecular weight of 541.04 g/mol.
Molecular Properties
| Compound Name | CID 160529153 |
| PubChem CID | 160529153 |
| Molecular Formula | C29H33ClN2O6 |
| Molecular Weight | 541.04 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(Cl)cnc1C(=O)Cc1ccc2c(c1)C1(COC(CC(=O)OC(C)(C)C)=N1)C1(COC1)C(C)(C)O2 |
| InChI | InChI=1S/C29H33ClN2O6/c1-17-9-19(30)13-31-25(17)21(33)11-18-7-8-22-20(10-18)29(28(14-35-15-28)27(5,6)37-22)16-36-23(32-29)12-24(34)38-26(2,3)4/h7-10,13H,11-12,14-16H2,1-6H3 |
| InChIKey | QVHOCLXTCWFRSH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 96.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.04 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 160529153 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160529153?
The IUPAC name of CID 160529153 (CID 160529153) is not available.
What is the SMILES notation for CID 160529153?
The canonical SMILES for CID 160529153 is Cc1cc(Cl)cnc1C(=O)Cc1ccc2c(c1)C1(COC(CC(=O)OC(C)(C)C)=N1)C1(COC1)C(C)(C)O2.
What is the InChIKey of CID 160529153?
The InChIKey is QVHOCLXTCWFRSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33ClN2O6/c1-17-9-19(30)13-31-25(17)21(33)11-18-7-8-22-20(10-18)29(28(14-35-15-28)27(5,6)37-22)16-36-23(32-29)12-24(34)38-26(2,3)4/h7-10,13H,11-12,14-16H2,1-6H3.
What are the key properties of CID 160529153?
CID 160529153 has a molecular weight of 541.04 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160529153 is sourced from PubChem (CID 160529153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).