C28H31ClN2O5 — CID 159455011
CID 159455011 (PubChem CID 159455011) has the molecular formula C28H31ClN2O5 and a molecular weight of 511.02 g/mol.
| Compound Name | CID 159455011 |
|---|---|
| PubChem CID | 159455011 |
| Molecular Formula | C28H31ClN2O5 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)CC1=N[C@@]2(CO1)c1cc(CC(=O)c3ccc(Cl)cn3)ccc1OC(C)(C)C21CC1 |
| InChI | InChI=1S/C28H31ClN2O5/c1-25(2,3)36-24(33)14-23-31-28(16-34-23)19-12-17(13-21(32)20-8-7-18(29)15-30-20)6-9-22(19)35-26(4,5)27(28)10-11-27/h6-9,12,15H,10-11,13-14,16H2,1-5H3/t28-/m0/s1 |
| InChIKey | LTVXEUWTFWOYPQ-NDEPHWFRSA-N |
| XLogP | 5.47 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |