About CID 159455011
CID 159455011 (PubChem CID 159455011) has the molecular formula C28H31ClN2O5
and a molecular weight of 511.02 g/mol.
Molecular Properties
| Compound Name | CID 159455011 |
| PubChem CID | 159455011 |
| Molecular Formula | C28H31ClN2O5 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)CC1=N[C@@]2(CO1)c1cc(CC(=O)c3ccc(Cl)cn3)ccc1OC(C)(C)C21CC1 |
| InChI | InChI=1S/C28H31ClN2O5/c1-25(2,3)36-24(33)14-23-31-28(16-34-23)19-12-17(13-21(32)20-8-7-18(29)15-30-20)6-9-22(19)35-26(4,5)27(28)10-11-27/h6-9,12,15H,10-11,13-14,16H2,1-5H3/t28-/m0/s1 |
| InChIKey | LTVXEUWTFWOYPQ-NDEPHWFRSA-N |
| XLogP | 5.47 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 159455011 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159455011?
The IUPAC name of CID 159455011 (CID 159455011) is not available.
What is the SMILES notation for CID 159455011?
The canonical SMILES for CID 159455011 is CC(C)(C)OC(=O)CC1=N[C@@]2(CO1)c1cc(CC(=O)c3ccc(Cl)cn3)ccc1OC(C)(C)C21CC1.
What is the InChIKey of CID 159455011?
The InChIKey is LTVXEUWTFWOYPQ-NDEPHWFRSA-N. The full InChI is InChI=1S/C28H31ClN2O5/c1-25(2,3)36-24(33)14-23-31-28(16-34-23)19-12-17(13-21(32)20-8-7-18(29)15-30-20)6-9-22(19)35-26(4,5)27(28)10-11-27/h6-9,12,15H,10-11,13-14,16H2,1-5H3/t28-/m0/s1.
What are the key properties of CID 159455011?
CID 159455011 has a molecular weight of 511.02 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159455011 is sourced from PubChem (CID 159455011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).