C21H18F7N3O3 — CID 161449620
2-[3-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone (PubChem CID 161449620) has the molecular formula C21H18F7N3O3 and a molecular weight of 493.38 g/mol. Its IUPAC name is 2-[3-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone.
| Compound Name | 2-[3-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 161449620 |
| Molecular Formula | C21H18F7N3O3 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-[3-[(4S,6S)-2-amino-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanone |
| SMILES | C[C@@]1(c2cc(CC(=O)c3ccc(OCC(F)(F)F)cn3)ccc2F)C[C@@H](C(F)(F)F)OC(N)=N1 |
| InChI | InChI=1S/C21H18F7N3O3/c1-19(8-17(21(26,27)28)34-18(29)31-19)13-6-11(2-4-14(13)22)7-16(32)15-5-3-12(9-30-15)33-10-20(23,24)25/h2-6,9,17H,7-8,10H2,1H3,(H2,29,31)/t17-,19-/m0/s1 |
| InChIKey | WAIYGRVZORDWGH-HKUYNNGSSA-N |
| XLogP | 4.47 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |