C15H19F2N3OS — CID 144698713
(4S,4aR,7aR)-4-(5-amino-3-fluoro-2-methylsulfanylphenyl)-4-(fluoromethyl)-5,6,7,7a-tetrahydro-4aH-cyclopenta[e][1,3]oxazin-2-amine (PubChem CID 144698713) has the molecular formula C15H19F2N3OS and a molecular weight of 327.40 g/mol. Its IUPAC name is (4S,4aR,7aR)-4-(5-amino-3-fluoro-2-methylsulfanylphenyl)-4-(fluoromethyl)-5,6,7,7a-tetrahydro-4aH-cyclopenta[e][1,3]oxazin-2-amine.
| Compound Name | (4S,4aR,7aR)-4-(5-amino-3-fluoro-2-methylsulfanylphenyl)-4-(fluoromethyl)-5,6,7,7a-tetrahydro-4aH-cyclopenta[e][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 144698713 |
| Molecular Formula | C15H19F2N3OS |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (4S,4aR,7aR)-4-(5-amino-3-fluoro-2-methylsulfanylphenyl)-4-(fluoromethyl)-5,6,7,7a-tetrahydro-4aH-cyclopenta[e][1,3]oxazin-2-amine |
| SMILES | CSc1c(F)cc(N)cc1[C@@]1(CF)N=C(N)O[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C15H19F2N3OS/c1-22-13-10(5-8(18)6-11(13)17)15(7-16)9-3-2-4-12(9)21-14(19)20-15/h5-6,9,12H,2-4,7,18H2,1H3,(H2,19,20)/t9-,12+,15-/m0/s1 |
| InChIKey | WEJFAXLQEMTSLP-UAKXVISKSA-N |
| XLogP | 2.81 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|