C14H16F2N2O2 — CID 157405724
(4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine (PubChem CID 157405724) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is (4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine.
| Compound Name | (4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 157405724 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (4S,4aS,5S,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine |
| SMILES | C[C@@H]1OC[C@H]2OC(N)=N[C@](CF)(c3ccccc3F)[C@@H]12 |
| InChI | InChI=1S/C14H16F2N2O2/c1-8-12-11(6-19-8)20-13(17)18-14(12,7-15)9-4-2-3-5-10(9)16/h2-5,8,11-12H,6-7H2,1H3,(H2,17,18)/t8-,11+,12-,14+/m0/s1 |
| InChIKey | CIKMQDUDVQFOLZ-RBQWDTSBSA-N |
| XLogP | 1.74 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |