C22H31FN2OSi — CID 123817979
(1R,5S,6R)-5-(2-fluorophenyl)-5-[2-tri(propan-2-yl)silylethynyl]-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine (PubChem CID 123817979) has the molecular formula C22H31FN2OSi and a molecular weight of 386.59 g/mol. Its IUPAC name is (1R,5S,6R)-5-(2-fluorophenyl)-5-[2-tri(propan-2-yl)silylethynyl]-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine.
| Compound Name | (1R,5S,6R)-5-(2-fluorophenyl)-5-[2-tri(propan-2-yl)silylethynyl]-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine |
|---|---|
| PubChem CID | 123817979 |
| Molecular Formula | C22H31FN2OSi |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | (1R,5S,6R)-5-(2-fluorophenyl)-5-[2-tri(propan-2-yl)silylethynyl]-2-oxa-4-azabicyclo[4.1.0]hept-3-en-3-amine |
| SMILES | CC(C)[Si](C#C[C@]1(c2ccccc2F)N=C(N)O[C@@H]2C[C@@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H31FN2OSi/c1-14(2)27(15(3)4,16(5)6)12-11-22(17-9-7-8-10-19(17)23)18-13-20(18)26-21(24)25-22/h7-10,14-16,18,20H,13H2,1-6H3,(H2,24,25)/t18-,20+,22+/m0/s1 |
| InChIKey | CRKJBKFENOLSCN-CZTZKLFOSA-N |
| XLogP | 4.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|